C23H19Cl2NO3 — CID 2343937
[2-(2,4-dichloroanilino)-2-oxoethyl] 3,3-diphenylpropanoate (PubChem CID 2343937) has the molecular formula C23H19Cl2NO3 and a molecular weight of 428.32 g/mol. Its IUPAC name is [2-(2,4-dichloroanilino)-2-oxoethyl] 3,3-diphenylpropanoate.
| Compound Name | [2-(2,4-dichloroanilino)-2-oxoethyl] 3,3-diphenylpropanoate |
|---|---|
| PubChem CID | 2343937 |
| Molecular Formula | C23H19Cl2NO3 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | [2-(2,4-dichloroanilino)-2-oxoethyl] 3,3-diphenylpropanoate |
| SMILES | O=C(COC(=O)CC(c1ccccc1)c1ccccc1)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H19Cl2NO3/c24-18-11-12-21(20(25)13-18)26-22(27)15-29-23(28)14-19(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-13,19H,14-15H2,(H,26,27) |
| InChIKey | LHMSPMVGVVXOEE-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |