C11H15N2O9P — CID 19936032
[[(3,4-dimethoxyphenyl)-nitromethoxy]carbonylamino]methylphosphonic acid (PubChem CID 19936032) has the molecular formula C11H15N2O9P and a molecular weight of 350.22 g/mol. Its IUPAC name is [[(3,4-dimethoxyphenyl)-nitromethoxy]carbonylamino]methylphosphonic acid.
| Compound Name | [[(3,4-dimethoxyphenyl)-nitromethoxy]carbonylamino]methylphosphonic acid |
|---|---|
| PubChem CID | 19936032 |
| Molecular Formula | C11H15N2O9P |
| Molecular Weight | 350.22 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | [[(3,4-dimethoxyphenyl)-nitromethoxy]carbonylamino]methylphosphonic acid |
| SMILES | COc1ccc(C(OC(=O)NCP(=O)(O)O)[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C11H15N2O9P/c1-20-8-4-3-7(5-9(8)21-2)10(13(15)16)22-11(14)12-6-23(17,18)19/h3-5,10H,6H2,1-2H3,(H,12,14)(H2,17,18,19) |
| InChIKey | XBJPVGHWWXQYEZ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 157.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.22 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|