C12H14NO5S- — CID 134109071
S-[1-(3,4-dimethoxyphenyl)-2-nitroethyl] ethanethioate (PubChem CID 134109071) has the molecular formula C12H14NO5S- and a molecular weight of 284.31 g/mol. Its IUPAC name is S-[1-(3,4-dimethoxyphenyl)-2-nitroethyl] ethanethioate.
| Compound Name | S-[1-(3,4-dimethoxyphenyl)-2-nitroethyl] ethanethioate |
|---|---|
| PubChem CID | 134109071 |
| Molecular Formula | C12H14NO5S- |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | S-[1-(3,4-dimethoxyphenyl)-2-nitroethyl] ethanethioate |
| SMILES | COc1ccc(C([CH-][N+](=O)[O-])SC(C)=O)cc1OC |
| InChI | InChI=1S/C12H14NO5S/c1-8(14)19-12(7-13(15)16)9-4-5-10(17-2)11(6-9)18-3/h4-7,12H,1-3H3/q-1 |
| InChIKey | LXXYTEXNNIOSEV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|