C16H17NO5 — CID 91678407
(3,4-dimethoxyphenyl)-(4-methyl-3-nitrophenyl)methanol (PubChem CID 91678407) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)-(4-methyl-3-nitrophenyl)methanol.
| Compound Name | (3,4-dimethoxyphenyl)-(4-methyl-3-nitrophenyl)methanol |
|---|---|
| PubChem CID | 91678407 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | (3,4-dimethoxyphenyl)-(4-methyl-3-nitrophenyl)methanol |
| SMILES | COc1ccc(C(O)c2ccc(C)c([N+](=O)[O-])c2)cc1OC |
| InChI | InChI=1S/C16H17NO5/c1-10-4-5-11(8-13(10)17(19)20)16(18)12-6-7-14(21-2)15(9-12)22-3/h4-9,16,18H,1-3H3 |
| InChIKey | JMEFOODYKHEDDC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|