C15H21NO11 — CID 22856144
(2S,3S,4S,5S,6S)-6-[[(3,4-dimethoxyphenyl)-nitromethoxy]-hydroxymethyl]oxane-2,3,4,5-tetrol (PubChem CID 22856144) has the molecular formula C15H21NO11 and a molecular weight of 391.33 g/mol. Its IUPAC name is (2S,3S,4S,5S,6S)-6-[[(3,4-dimethoxyphenyl)-nitromethoxy]-hydroxymethyl]oxane-2,3,4,5-tetrol.
| Compound Name | (2S,3S,4S,5S,6S)-6-[[(3,4-dimethoxyphenyl)-nitromethoxy]-hydroxymethyl]oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 22856144 |
| Molecular Formula | C15H21NO11 |
| Molecular Weight | 391.33 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | (2S,3S,4S,5S,6S)-6-[[(3,4-dimethoxyphenyl)-nitromethoxy]-hydroxymethyl]oxane-2,3,4,5-tetrol |
| SMILES | COc1ccc(C(OC(O)[C@H]2O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]2O)[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C15H21NO11/c1-24-7-4-3-6(5-8(7)25-2)13(16(22)23)27-15(21)12-10(18)9(17)11(19)14(20)26-12/h3-5,9-15,17-21H,1-2H3/t9-,10-,11-,12-,13?,14-,15?/m0/s1 |
| InChIKey | GACYVQSERDYXJE-SLSUIPKCSA-N |
| XLogP | -1.89 |
| TPSA | 181.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.33 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|