C11H13NO2S — CID 117033972
3-(2,4-dimethoxyphenyl)sulfanylpropanenitrile (PubChem CID 117033972) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)sulfanylpropanenitrile.
| Compound Name | 3-(2,4-dimethoxyphenyl)sulfanylpropanenitrile |
|---|---|
| PubChem CID | 117033972 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)sulfanylpropanenitrile |
| SMILES | COc1ccc(SCCC#N)c(OC)c1 |
| InChI | InChI=1S/C11H13NO2S/c1-13-9-4-5-11(10(8-9)14-2)15-7-3-6-12/h4-5,8H,3,7H2,1-2H3 |
| InChIKey | UWNCPGLHJLEQAX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|