C12H15NO2S — CID 117035600
2-(2,5-dimethoxyphenyl)sulfanylbutanenitrile (PubChem CID 117035600) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)sulfanylbutanenitrile.
| Compound Name | 2-(2,5-dimethoxyphenyl)sulfanylbutanenitrile |
|---|---|
| PubChem CID | 117035600 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)sulfanylbutanenitrile |
| SMILES | CCC(C#N)Sc1cc(OC)ccc1OC |
| InChI | InChI=1S/C12H15NO2S/c1-4-10(8-13)16-12-7-9(14-2)5-6-11(12)15-3/h5-7,10H,4H2,1-3H3 |
| InChIKey | PHPCRDIKVXQWDQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |