C20H23NO6S — CID 20841316
(Z)-but-2-enedioic acid;1-[2-(2,4-dimethoxyphenyl)sulfanylphenyl]-N-methylmethanamine (PubChem CID 20841316) has the molecular formula C20H23NO6S and a molecular weight of 405.47 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-[2-(2,4-dimethoxyphenyl)sulfanylphenyl]-N-methylmethanamine.
| Compound Name | (Z)-but-2-enedioic acid;1-[2-(2,4-dimethoxyphenyl)sulfanylphenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 20841316 |
| Molecular Formula | C20H23NO6S |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-[2-(2,4-dimethoxyphenyl)sulfanylphenyl]-N-methylmethanamine |
| SMILES | CNCc1ccccc1Sc1ccc(OC)cc1OC.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C16H19NO2S.C4H4O4/c1-17-11-12-6-4-5-7-15(12)20-16-9-8-13(18-2)10-14(16)19-3;5-3(6)1-2-4(7)8/h4-10,17H,11H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | WPENDJBTYBDMPC-BTJKTKAUSA-N |
| XLogP | 3.29 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|