C18H19NO5S — CID 6449759
(E)-but-2-enedioic acid;2-[2-(methylaminomethyl)phenyl]sulfanylphenol (PubChem CID 6449759) has the molecular formula C18H19NO5S and a molecular weight of 361.42 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-[2-(methylaminomethyl)phenyl]sulfanylphenol.
| Compound Name | (E)-but-2-enedioic acid;2-[2-(methylaminomethyl)phenyl]sulfanylphenol |
|---|---|
| PubChem CID | 6449759 |
| Molecular Formula | C18H19NO5S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | (E)-but-2-enedioic acid;2-[2-(methylaminomethyl)phenyl]sulfanylphenol |
| SMILES | CNCc1ccccc1Sc1ccccc1O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C14H15NOS.C4H4O4/c1-15-10-11-6-2-4-8-13(11)17-14-9-5-3-7-12(14)16;5-3(6)1-2-4(7)8/h2-9,15-16H,10H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | YYKXZVZMGDJOIT-WLHGVMLRSA-N |
| XLogP | 2.97 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|