C17H17NO5S — CID 127021148
4-[2-(aminomethyl)phenyl]sulfanylphenol;(Z)-but-2-enedioic acid (PubChem CID 127021148) has the molecular formula C17H17NO5S and a molecular weight of 347.39 g/mol. Its IUPAC name is 4-[2-(aminomethyl)phenyl]sulfanylphenol;(Z)-but-2-enedioic acid.
| Compound Name | 4-[2-(aminomethyl)phenyl]sulfanylphenol;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 127021148 |
| Molecular Formula | C17H17NO5S |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 4-[2-(aminomethyl)phenyl]sulfanylphenol;(Z)-but-2-enedioic acid |
| SMILES | NCc1ccccc1Sc1ccc(O)cc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C13H13NOS.C4H4O4/c14-9-10-3-1-2-4-13(10)16-12-7-5-11(15)6-8-12;5-3(6)1-2-4(7)8/h1-8,15H,9,14H2;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | MNZITAXOLZHOPO-BTJKTKAUSA-N |
| XLogP | 2.71 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|