C15H14O4S — CID 2824958
2-[2-(hydroxymethyl)-4-methoxyphenyl]sulfanylbenzoic acid (PubChem CID 2824958) has the molecular formula C15H14O4S and a molecular weight of 290.34 g/mol. Its IUPAC name is 2-[2-(hydroxymethyl)-4-methoxyphenyl]sulfanylbenzoic acid.
| Compound Name | 2-[2-(hydroxymethyl)-4-methoxyphenyl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 2824958 |
| Molecular Formula | C15H14O4S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 2-[2-(hydroxymethyl)-4-methoxyphenyl]sulfanylbenzoic acid |
| SMILES | COc1ccc(Sc2ccccc2C(=O)O)c(CO)c1 |
| InChI | InChI=1S/C15H14O4S/c1-19-11-6-7-13(10(8-11)9-16)20-14-5-3-2-4-12(14)15(17)18/h2-8,16H,9H2,1H3,(H,17,18) |
| InChIKey | UYDKZAIERWIOIK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |