C13H10ClF2NS — CID 62495474
[2-chloro-6-(2,5-difluorophenyl)sulfanylphenyl]methanamine (PubChem CID 62495474) has the molecular formula C13H10ClF2NS and a molecular weight of 285.75 g/mol. Its IUPAC name is [2-chloro-6-(2,5-difluorophenyl)sulfanylphenyl]methanamine.
| Compound Name | [2-chloro-6-(2,5-difluorophenyl)sulfanylphenyl]methanamine |
|---|---|
| PubChem CID | 62495474 |
| Molecular Formula | C13H10ClF2NS |
| Molecular Weight | 285.75 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | [2-chloro-6-(2,5-difluorophenyl)sulfanylphenyl]methanamine |
| SMILES | NCc1c(Cl)cccc1Sc1cc(F)ccc1F |
| InChI | InChI=1S/C13H10ClF2NS/c14-10-2-1-3-12(9(10)7-17)18-13-6-8(15)4-5-11(13)16/h1-6H,7,17H2 |
| InChIKey | VOGRUJHPHCYZHZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.75 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |