C21H15Cl2NO3S — CID 2812312
2-[[2-chloro-6-(4-chlorophenyl)sulfanylphenyl]methylcarbamoyl]benzoic acid (PubChem CID 2812312) has the molecular formula C21H15Cl2NO3S and a molecular weight of 432.33 g/mol. Its IUPAC name is 2-[[2-chloro-6-(4-chlorophenyl)sulfanylphenyl]methylcarbamoyl]benzoic acid.
| Compound Name | 2-[[2-chloro-6-(4-chlorophenyl)sulfanylphenyl]methylcarbamoyl]benzoic acid |
|---|---|
| PubChem CID | 2812312 |
| Molecular Formula | C21H15Cl2NO3S |
| Molecular Weight | 432.33 g/mol |
| Exact Mass | 431.01 |
| IUPAC Name | 2-[[2-chloro-6-(4-chlorophenyl)sulfanylphenyl]methylcarbamoyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)NCc1c(Cl)cccc1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H15Cl2NO3S/c22-13-8-10-14(11-9-13)28-19-7-3-6-18(23)17(19)12-24-20(25)15-4-1-2-5-16(15)21(26)27/h1-11H,12H2,(H,24,25)(H,26,27) |
| InChIKey | WAXOGRAUEZGHLG-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.33 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |