C21H18ClFN2O2 — CID 108988928
1-[4-[(4-chlorophenyl)methoxy]phenyl]-3-[(4-fluorophenyl)methyl]urea (PubChem CID 108988928) has the molecular formula C21H18ClFN2O2 and a molecular weight of 384.84 g/mol. Its IUPAC name is 1-[4-[(4-chlorophenyl)methoxy]phenyl]-3-[(4-fluorophenyl)methyl]urea.
| Compound Name | 1-[4-[(4-chlorophenyl)methoxy]phenyl]-3-[(4-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 108988928 |
| Molecular Formula | C21H18ClFN2O2 |
| Molecular Weight | 384.84 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 1-[4-[(4-chlorophenyl)methoxy]phenyl]-3-[(4-fluorophenyl)methyl]urea |
| SMILES | O=C(NCc1ccc(F)cc1)Nc1ccc(OCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H18ClFN2O2/c22-17-5-1-16(2-6-17)14-27-20-11-9-19(10-12-20)25-21(26)24-13-15-3-7-18(23)8-4-15/h1-12H,13-14H2,(H2,24,25,26) |
| InChIKey | CYQJHWIQLAKZOJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.84 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |