C25H23ClN4O3 — CID 170159287
1-[(4-chlorophenyl)methyl]-3-[4-(pyridin-3-yloxymethyl)phenyl]urea;pyridin-3-ol (PubChem CID 170159287) has the molecular formula C25H23ClN4O3 and a molecular weight of 462.94 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-[4-(pyridin-3-yloxymethyl)phenyl]urea;pyridin-3-ol.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-[4-(pyridin-3-yloxymethyl)phenyl]urea;pyridin-3-ol |
|---|---|
| PubChem CID | 170159287 |
| Molecular Formula | C25H23ClN4O3 |
| Molecular Weight | 462.94 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-[4-(pyridin-3-yloxymethyl)phenyl]urea;pyridin-3-ol |
| SMILES | O=C(NCc1ccc(Cl)cc1)Nc1ccc(COc2cccnc2)cc1.Oc1cccnc1 |
| InChI | InChI=1S/C20H18ClN3O2.C5H5NO/c21-17-7-3-15(4-8-17)12-23-20(25)24-18-9-5-16(6-10-18)14-26-19-2-1-11-22-13-19;7-5-2-1-3-6-4-5/h1-11,13H,12,14H2,(H2,23,24,25);1-4,7H |
| InChIKey | IVNXBCVYYKBZMU-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.94 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |