C18H13Cl4FN2O3 — CID 23454911
2-chloro-N-[[3-chloro-4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]carbamoyl]-6-fluorobenzamide (PubChem CID 23454911) has the molecular formula C18H13Cl4FN2O3 and a molecular weight of 466.12 g/mol. Its IUPAC name is 2-chloro-N-[[3-chloro-4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]carbamoyl]-6-fluorobenzamide.
| Compound Name | 2-chloro-N-[[3-chloro-4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]carbamoyl]-6-fluorobenzamide |
|---|---|
| PubChem CID | 23454911 |
| Molecular Formula | C18H13Cl4FN2O3 |
| Molecular Weight | 466.12 g/mol |
| Exact Mass | 463.97 |
| IUPAC Name | 2-chloro-N-[[3-chloro-4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]carbamoyl]-6-fluorobenzamide |
| SMILES | O=C(NC(=O)c1c(F)cccc1Cl)Nc1ccc(OCC2CC2(Cl)Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H13Cl4FN2O3/c19-11-2-1-3-13(23)15(11)16(26)25-17(27)24-10-4-5-14(12(20)6-10)28-8-9-7-18(9,21)22/h1-6,9H,7-8H2,(H2,24,25,26,27) |
| InChIKey | MDRRCUVJMOZINZ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.12 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|