C13H11ClFN5O2 — CID 6409882
2-chloro-6-fluoro-N-[[(6-methylpyridazin-3-yl)amino]carbamoyl]benzamide (PubChem CID 6409882) has the molecular formula C13H11ClFN5O2 and a molecular weight of 323.72 g/mol. Its IUPAC name is 2-chloro-6-fluoro-N-[[(6-methylpyridazin-3-yl)amino]carbamoyl]benzamide.
| Compound Name | 2-chloro-6-fluoro-N-[[(6-methylpyridazin-3-yl)amino]carbamoyl]benzamide |
|---|---|
| PubChem CID | 6409882 |
| Molecular Formula | C13H11ClFN5O2 |
| Molecular Weight | 323.72 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 2-chloro-6-fluoro-N-[[(6-methylpyridazin-3-yl)amino]carbamoyl]benzamide |
| SMILES | Cc1ccc(NNC(=O)NC(=O)c2c(F)cccc2Cl)nn1 |
| InChI | InChI=1S/C13H11ClFN5O2/c1-7-5-6-10(18-17-7)19-20-13(22)16-12(21)11-8(14)3-2-4-9(11)15/h2-6H,1H3,(H,18,19)(H2,16,20,21,22) |
| InChIKey | BXBAGGGLCZDTKY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.72 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|