C14H8Cl5N3O2 — CID 2798573
2,6-dichloro-N-[(2,4,6-trichloroanilino)carbamoyl]benzamide (PubChem CID 2798573) has the molecular formula C14H8Cl5N3O2 and a molecular weight of 427.50 g/mol. Its IUPAC name is 2,6-dichloro-N-[(2,4,6-trichloroanilino)carbamoyl]benzamide.
| Compound Name | 2,6-dichloro-N-[(2,4,6-trichloroanilino)carbamoyl]benzamide |
|---|---|
| PubChem CID | 2798573 |
| Molecular Formula | C14H8Cl5N3O2 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 424.91 |
| IUPAC Name | 2,6-dichloro-N-[(2,4,6-trichloroanilino)carbamoyl]benzamide |
| SMILES | O=C(NNc1c(Cl)cc(Cl)cc1Cl)NC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H8Cl5N3O2/c15-6-4-9(18)12(10(19)5-6)21-22-14(24)20-13(23)11-7(16)2-1-3-8(11)17/h1-5,21H,(H2,20,22,23,24) |
| InChIKey | YWSWBJWKBARPCA-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|