About 2,4,4-trifluoro-2-(trifluoromethyl)-1,3-benzodioxine
2,4,4-trifluoro-2-(trifluoromethyl)-1,3-benzodioxine (PubChem CID 44890796) has the molecular formula C9H4F6O2
and a molecular weight of 258.12 g/mol. Its IUPAC name is 2,4,4-trifluoro-2-(trifluoromethyl)-1,3-benzodioxine.
Analyze 2,4,4-trifluoro-2-(trifluoromethyl)-1,3-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,4-trifluoro-2-(trifluoromethyl)-1,3-benzodioxine?
The IUPAC name of 2,4,4-trifluoro-2-(trifluoromethyl)-1,3-benzodioxine (CID 44890796) is 2,4,4-trifluoro-2-(trifluoromethyl)-1,3-benzodioxine.
What is the SMILES notation for 2,4,4-trifluoro-2-(trifluoromethyl)-1,3-benzodioxine?
The canonical SMILES for 2,4,4-trifluoro-2-(trifluoromethyl)-1,3-benzodioxine is FC1(F)OC(F)(C(F)(F)F)Oc2ccccc21.
What is the InChIKey of 2,4,4-trifluoro-2-(trifluoromethyl)-1,3-benzodioxine?
The InChIKey is BMTPREMSPODDIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4F6O2/c10-7(11)5-3-1-2-4-6(5)16-9(15,17-7)8(12,13)14/h1-4H.
What are the key properties of 2,4,4-trifluoro-2-(trifluoromethyl)-1,3-benzodioxine?
2,4,4-trifluoro-2-(trifluoromethyl)-1,3-benzodioxine has a molecular weight of 258.12 g/mol, XLogP of 3.33, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,4-trifluoro-2-(trifluoromethyl)-1,3-benzodioxine is sourced from PubChem (CID 44890796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).