C8H7Cl3NO2+ — CID 6920205
[2-(trichloromethyl)-1,3-benzodioxol-2-yl]azanium (PubChem CID 6920205) has the molecular formula C8H7Cl3NO2+ and a molecular weight of 255.51 g/mol. Its IUPAC name is [2-(trichloromethyl)-1,3-benzodioxol-2-yl]azanium.
| Compound Name | [2-(trichloromethyl)-1,3-benzodioxol-2-yl]azanium |
|---|---|
| PubChem CID | 6920205 |
| Molecular Formula | C8H7Cl3NO2+ |
| Molecular Weight | 255.51 g/mol |
| Exact Mass | 253.95 |
| IUPAC Name | [2-(trichloromethyl)-1,3-benzodioxol-2-yl]azanium |
| SMILES | [NH3+]C1(C(Cl)(Cl)Cl)Oc2ccccc2O1 |
| InChI | InChI=1S/C8H6Cl3NO2/c9-7(10,11)8(12)13-5-3-1-2-4-6(5)14-8/h1-4H,12H2/p+1 |
| InChIKey | LARUWCAETBGIDX-UHFFFAOYSA-O |
| XLogP | 1.72 |
| TPSA | 46.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.51 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|