C16H16O4 — CID 21273269
1,3-benzodioxole;2,2-dimethyl-1,3-benzodioxole (PubChem CID 21273269) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is 1,3-benzodioxole;2,2-dimethyl-1,3-benzodioxole.
| Compound Name | 1,3-benzodioxole;2,2-dimethyl-1,3-benzodioxole |
|---|---|
| PubChem CID | 21273269 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 1,3-benzodioxole;2,2-dimethyl-1,3-benzodioxole |
| SMILES | CC1(C)Oc2ccccc2O1.c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C9H10O2.C7H6O2/c1-9(2)10-7-5-3-4-6-8(7)11-9;1-2-4-7-6(3-1)8-5-9-7/h3-6H,1-2H3;1-4H,5H2 |
| InChIKey | CQXOTHXANDUTID-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |