C10H12O2 — CID 45117132
4,4-dimethyl-1,3-benzodioxine (PubChem CID 45117132) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 4,4-dimethyl-1,3-benzodioxine.
| Compound Name | 4,4-dimethyl-1,3-benzodioxine |
|---|---|
| PubChem CID | 45117132 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 4,4-dimethyl-1,3-benzodioxine |
| SMILES | CC1(C)OCOc2ccccc21 |
| InChI | InChI=1S/C10H12O2/c1-10(2)8-5-3-4-6-9(8)11-7-12-10/h3-6H,7H2,1-2H3 |
| InChIKey | MHMZZIWBLDQCIN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |