C11H6Cl3NO3 — CID 121223068
4-(trichloromethyl)chromeno[3,4-d][1,2]oxazol-4-ol (PubChem CID 121223068) has the molecular formula C11H6Cl3NO3 and a molecular weight of 306.53 g/mol. Its IUPAC name is 4-(trichloromethyl)chromeno[3,4-d][1,2]oxazol-4-ol.
| Compound Name | 4-(trichloromethyl)chromeno[3,4-d][1,2]oxazol-4-ol |
|---|---|
| PubChem CID | 121223068 |
| Molecular Formula | C11H6Cl3NO3 |
| Molecular Weight | 306.53 g/mol |
| Exact Mass | 304.94 |
| IUPAC Name | 4-(trichloromethyl)chromeno[3,4-d][1,2]oxazol-4-ol |
| SMILES | OC1(C(Cl)(Cl)Cl)Oc2ccccc2-c2oncc21 |
| InChI | InChI=1S/C11H6Cl3NO3/c12-11(13,14)10(16)7-5-15-18-9(7)6-3-1-2-4-8(6)17-10/h1-5,16H |
| InChIKey | XXZVRJVNFWVCTR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.53 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|