C14H11F4NO3 — CID 101421665
7,9-dimethyl-4-(1,1,2,2-tetrafluoroethyl)chromeno[3,4-d][1,2]oxazol-4-ol (PubChem CID 101421665) has the molecular formula C14H11F4NO3 and a molecular weight of 317.24 g/mol. Its IUPAC name is 7,9-dimethyl-4-(1,1,2,2-tetrafluoroethyl)chromeno[3,4-d][1,2]oxazol-4-ol.
| Compound Name | 7,9-dimethyl-4-(1,1,2,2-tetrafluoroethyl)chromeno[3,4-d][1,2]oxazol-4-ol |
|---|---|
| PubChem CID | 101421665 |
| Molecular Formula | C14H11F4NO3 |
| Molecular Weight | 317.24 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 7,9-dimethyl-4-(1,1,2,2-tetrafluoroethyl)chromeno[3,4-d][1,2]oxazol-4-ol |
| SMILES | Cc1cc(C)c2c(c1)OC(O)(C(F)(F)C(F)F)c1cnoc1-2 |
| InChI | InChI=1S/C14H11F4NO3/c1-6-3-7(2)10-9(4-6)21-14(20,13(17,18)12(15)16)8-5-19-22-11(8)10/h3-5,12,20H,1-2H3 |
| InChIKey | IUGOXBRUHRRRQX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.24 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|