C13H9F4NO3 — CID 101421658
8-methyl-4-(1,1,2,2-tetrafluoroethyl)chromeno[3,4-d][1,2]oxazol-4-ol (PubChem CID 101421658) has the molecular formula C13H9F4NO3 and a molecular weight of 303.21 g/mol. Its IUPAC name is 8-methyl-4-(1,1,2,2-tetrafluoroethyl)chromeno[3,4-d][1,2]oxazol-4-ol.
| Compound Name | 8-methyl-4-(1,1,2,2-tetrafluoroethyl)chromeno[3,4-d][1,2]oxazol-4-ol |
|---|---|
| PubChem CID | 101421658 |
| Molecular Formula | C13H9F4NO3 |
| Molecular Weight | 303.21 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 8-methyl-4-(1,1,2,2-tetrafluoroethyl)chromeno[3,4-d][1,2]oxazol-4-ol |
| SMILES | Cc1ccc2c(c1)-c1oncc1C(O)(C(F)(F)C(F)F)O2 |
| InChI | InChI=1S/C13H9F4NO3/c1-6-2-3-9-7(4-6)10-8(5-18-21-10)13(19,20-9)12(16,17)11(14)15/h2-5,11,19H,1H3 |
| InChIKey | KRVQODKVENVFGA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.21 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|