C10H5F6NO2 — CID 140979389
6-(1,1,2,3,3,3-hexafluoropropoxy)-1,2-benzoxazole (PubChem CID 140979389) has the molecular formula C10H5F6NO2 and a molecular weight of 285.14 g/mol. Its IUPAC name is 6-(1,1,2,3,3,3-hexafluoropropoxy)-1,2-benzoxazole.
| Compound Name | 6-(1,1,2,3,3,3-hexafluoropropoxy)-1,2-benzoxazole |
|---|---|
| PubChem CID | 140979389 |
| Molecular Formula | C10H5F6NO2 |
| Molecular Weight | 285.14 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 6-(1,1,2,3,3,3-hexafluoropropoxy)-1,2-benzoxazole |
| SMILES | FC(C(F)(F)F)C(F)(F)Oc1ccc2cnoc2c1 |
| InChI | InChI=1S/C10H5F6NO2/c11-8(9(12,13)14)10(15,16)18-6-2-1-5-4-17-19-7(5)3-6/h1-4,8H |
| InChIKey | NYSLWDFISJNOCT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.14 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |