C15H10FNO3 — CID 39347721
[3-(4-fluorophenyl)-1,2-benzoxazol-6-yl] acetate (PubChem CID 39347721) has the molecular formula C15H10FNO3 and a molecular weight of 271.25 g/mol. Its IUPAC name is [3-(4-fluorophenyl)-1,2-benzoxazol-6-yl] acetate.
| Compound Name | [3-(4-fluorophenyl)-1,2-benzoxazol-6-yl] acetate |
|---|---|
| PubChem CID | 39347721 |
| Molecular Formula | C15H10FNO3 |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | [3-(4-fluorophenyl)-1,2-benzoxazol-6-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(-c3ccc(F)cc3)noc2c1 |
| InChI | InChI=1S/C15H10FNO3/c1-9(18)19-12-6-7-13-14(8-12)20-17-15(13)10-2-4-11(16)5-3-10/h2-8H,1H3 |
| InChIKey | WOANUIOOANORLD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|