C23H25NO5 — CID 24776381
2-[(1S)-5-[3-[(3,7-dimethyl-1,2-benzoxazol-6-yl)oxy]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid (PubChem CID 24776381) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-[(1S)-5-[3-[(3,7-dimethyl-1,2-benzoxazol-6-yl)oxy]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid.
| Compound Name | 2-[(1S)-5-[3-[(3,7-dimethyl-1,2-benzoxazol-6-yl)oxy]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid |
|---|---|
| PubChem CID | 24776381 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 2-[(1S)-5-[3-[(3,7-dimethyl-1,2-benzoxazol-6-yl)oxy]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid |
| SMILES | Cc1noc2c(C)c(OCCCOc3ccc4c(c3)CC[C@H]4CC(=O)O)ccc12 |
| InChI | InChI=1S/C23H25NO5/c1-14-21(9-8-19-15(2)24-29-23(14)19)28-11-3-10-27-18-6-7-20-16(12-18)4-5-17(20)13-22(25)26/h6-9,12,17H,3-5,10-11,13H2,1-2H3,(H,25,26)/t17-/m0/s1 |
| InChIKey | GYLMBHYEEPSETC-KRWDZBQOSA-N |
| XLogP | 4.80 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|