C10H5NO3 — CID 86219695
chromeno[3,4-d][1,2]oxazol-4-one (PubChem CID 86219695) has the molecular formula C10H5NO3 and a molecular weight of 187.15 g/mol. Its IUPAC name is chromeno[3,4-d][1,2]oxazol-4-one.
| Compound Name | chromeno[3,4-d][1,2]oxazol-4-one |
|---|---|
| PubChem CID | 86219695 |
| Molecular Formula | C10H5NO3 |
| Molecular Weight | 187.15 g/mol |
| Exact Mass | 187.03 |
| IUPAC Name | chromeno[3,4-d][1,2]oxazol-4-one |
| SMILES | O=c1oc2ccccc2c2oncc12 |
| InChI | InChI=1S/C10H5NO3/c12-10-7-5-11-14-9(7)6-3-1-2-4-8(6)13-10/h1-5H |
| InChIKey | OGSRUOYFJVWVBS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.15 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|