C11H7NO3 — CID 72698172
4-methylpyrano[2,3-e][1,2]benzoxazol-2-one (PubChem CID 72698172) has the molecular formula C11H7NO3 and a molecular weight of 201.18 g/mol. Its IUPAC name is 4-methylpyrano[2,3-e][1,2]benzoxazol-2-one.
| Compound Name | 4-methylpyrano[2,3-e][1,2]benzoxazol-2-one |
|---|---|
| PubChem CID | 72698172 |
| Molecular Formula | C11H7NO3 |
| Molecular Weight | 201.18 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 4-methylpyrano[2,3-e][1,2]benzoxazol-2-one |
| SMILES | Cc1cc(=O)oc2c1ccc1oncc12 |
| InChI | InChI=1S/C11H7NO3/c1-6-4-10(13)14-11-7(6)2-3-9-8(11)5-12-15-9/h2-5H,1H3 |
| InChIKey | UENYVGGCAGGQJP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.18 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|