C12H7F4NO3 — CID 101421657
4-(1,1,2,2-tetrafluoroethyl)chromeno[3,4-d][1,2]oxazol-4-ol (PubChem CID 101421657) has the molecular formula C12H7F4NO3 and a molecular weight of 289.18 g/mol. Its IUPAC name is 4-(1,1,2,2-tetrafluoroethyl)chromeno[3,4-d][1,2]oxazol-4-ol.
| Compound Name | 4-(1,1,2,2-tetrafluoroethyl)chromeno[3,4-d][1,2]oxazol-4-ol |
|---|---|
| PubChem CID | 101421657 |
| Molecular Formula | C12H7F4NO3 |
| Molecular Weight | 289.18 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 4-(1,1,2,2-tetrafluoroethyl)chromeno[3,4-d][1,2]oxazol-4-ol |
| SMILES | OC1(C(F)(F)C(F)F)Oc2ccccc2-c2oncc21 |
| InChI | InChI=1S/C12H7F4NO3/c13-10(14)11(15,16)12(18)7-5-17-20-9(7)6-3-1-2-4-8(6)19-12/h1-5,10,18H |
| InChIKey | IREJWBWHAVDUMM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.18 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|