C24H35NO4 — CID 155568163
3-[4,4-dimethyl-7-(2-methyloctan-2-yl)chromeno[3,4-d][1,2]oxazol-9-yl]oxypropan-1-ol (PubChem CID 155568163) has the molecular formula C24H35NO4 and a molecular weight of 401.55 g/mol. Its IUPAC name is 3-[4,4-dimethyl-7-(2-methyloctan-2-yl)chromeno[3,4-d][1,2]oxazol-9-yl]oxypropan-1-ol.
| Compound Name | 3-[4,4-dimethyl-7-(2-methyloctan-2-yl)chromeno[3,4-d][1,2]oxazol-9-yl]oxypropan-1-ol |
|---|---|
| PubChem CID | 155568163 |
| Molecular Formula | C24H35NO4 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | 3-[4,4-dimethyl-7-(2-methyloctan-2-yl)chromeno[3,4-d][1,2]oxazol-9-yl]oxypropan-1-ol |
| SMILES | CCCCCCC(C)(C)c1cc(OCCCO)c2c(c1)OC(C)(C)c1cnoc1-2 |
| InChI | InChI=1S/C24H35NO4/c1-6-7-8-9-11-23(2,3)17-14-19(27-13-10-12-26)21-20(15-17)28-24(4,5)18-16-25-29-22(18)21/h14-16,26H,6-13H2,1-5H3 |
| InChIKey | JDHQJYQOJVPVHO-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 64.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|