C24H38O3 — CID 11660778
(6aR,9S,10aR)-1-methoxy-6,6-dimethyl-3-(2-methylheptan-2-yl)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-9-ol (PubChem CID 11660778) has the molecular formula C24H38O3 and a molecular weight of 374.57 g/mol. Its IUPAC name is (6aR,9S,10aR)-1-methoxy-6,6-dimethyl-3-(2-methylheptan-2-yl)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-9-ol.
| Compound Name | (6aR,9S,10aR)-1-methoxy-6,6-dimethyl-3-(2-methylheptan-2-yl)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-9-ol |
|---|---|
| PubChem CID | 11660778 |
| Molecular Formula | C24H38O3 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | (6aR,9S,10aR)-1-methoxy-6,6-dimethyl-3-(2-methylheptan-2-yl)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-9-ol |
| SMILES | CCCCCC(C)(C)c1cc(OC)c2c(c1)OC(C)(C)[C@@H]1CC[C@H](O)C[C@@H]21 |
| InChI | InChI=1S/C24H38O3/c1-7-8-9-12-23(2,3)16-13-20(26-6)22-18-15-17(25)10-11-19(18)24(4,5)27-21(22)14-16/h13-14,17-19,25H,7-12,15H2,1-6H3/t17-,18+,19+/m0/s1 |
| InChIKey | LDEMFYDHJXZOFB-IPMKNSEASA-N |
| XLogP | 5.97 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|