C26H38F2O3 — CID 59864396
[6,6-difluoro-9-methyl-3-(2-methyloctan-2-yl)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-yl] propanoate (PubChem CID 59864396) has the molecular formula C26H38F2O3 and a molecular weight of 436.58 g/mol. Its IUPAC name is [6,6-difluoro-9-methyl-3-(2-methyloctan-2-yl)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-yl] propanoate.
| Compound Name | [6,6-difluoro-9-methyl-3-(2-methyloctan-2-yl)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-yl] propanoate |
|---|---|
| PubChem CID | 59864396 |
| Molecular Formula | C26H38F2O3 |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | [6,6-difluoro-9-methyl-3-(2-methyloctan-2-yl)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-yl] propanoate |
| SMILES | CCCCCCC(C)(C)c1cc(OC(=O)CC)c2c(c1)OC(F)(F)C1CCC(C)CC21 |
| InChI | InChI=1S/C26H38F2O3/c1-6-8-9-10-13-25(4,5)18-15-21(30-23(29)7-2)24-19-14-17(3)11-12-20(19)26(27,28)31-22(24)16-18/h15-17,19-20H,6-14H2,1-5H3 |
| InChIKey | RLCGLLYYQJIZIZ-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|