C22H30F2O3 — CID 59864415
(6,6-difluoro-9-methyl-3-pentyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-yl) propanoate (PubChem CID 59864415) has the molecular formula C22H30F2O3 and a molecular weight of 380.48 g/mol. Its IUPAC name is (6,6-difluoro-9-methyl-3-pentyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-yl) propanoate.
| Compound Name | (6,6-difluoro-9-methyl-3-pentyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-yl) propanoate |
|---|---|
| PubChem CID | 59864415 |
| Molecular Formula | C22H30F2O3 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | (6,6-difluoro-9-methyl-3-pentyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-yl) propanoate |
| SMILES | CCCCCc1cc(OC(=O)CC)c2c(c1)OC(F)(F)C1CCC(C)CC21 |
| InChI | InChI=1S/C22H30F2O3/c1-4-6-7-8-15-12-18(26-20(25)5-2)21-16-11-14(3)9-10-17(16)22(23,24)27-19(21)13-15/h12-14,16-17H,4-11H2,1-3H3 |
| InChIKey | LMIZVSQPSNUILX-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|