C44H64O6 — CID 172870027
2-O-[(6aR,9S,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-yl] 1-O-[3-hydroxy-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-5-pentylphenyl] oxalate (PubChem CID 172870027) has the molecular formula C44H64O6 and a molecular weight of 688.99 g/mol. Its IUPAC name is 2-O-[(6aR,9S,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-yl] 1-O-[3-hydroxy-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-5-pentylphenyl] oxalate.
| Compound Name | 2-O-[(6aR,9S,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-yl] 1-O-[3-hydroxy-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-5-pentylphenyl] oxalate |
|---|---|
| PubChem CID | 172870027 |
| Molecular Formula | C44H64O6 |
| Molecular Weight | 688.99 g/mol |
| Exact Mass | 688.47 |
| IUPAC Name | 2-O-[(6aR,9S,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-yl] 1-O-[3-hydroxy-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-5-pentylphenyl] oxalate |
| SMILES | CCCCCc1cc(OC(=O)C(=O)Oc2cc(CCCCC)cc(O)c2[C@@H]2C[C@H](C)CC[C@H]2C(C)C)c2c(c1)OC(C)(C)[C@@H]1CC[C@H](C)C[C@@H]21 |
| InChI | InChI=1S/C44H64O6/c1-9-11-13-15-30-23-36(45)40(33-21-28(5)17-19-32(33)27(3)4)37(24-30)48-42(46)43(47)49-38-25-31(16-14-12-10-2)26-39-41(38)34-22-29(6)18-20-35(34)44(7,8)50-39/h23-29,32-35,45H,9-22H2,1-8H3/t28-,29+,32+,33-,34-,35-/m1/s1 |
| InChIKey | FAFMRRQHIBAWQT-IBPIJWBLSA-N |
| XLogP | 11.24 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.99 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|