C27H44O7 — CID 172869068
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[3-hydroxy-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-5-pentylphenoxy]oxane-3,4,5-triol (PubChem CID 172869068) has the molecular formula C27H44O7 and a molecular weight of 480.64 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[3-hydroxy-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-5-pentylphenoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[3-hydroxy-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-5-pentylphenoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 172869068 |
| Molecular Formula | C27H44O7 |
| Molecular Weight | 480.64 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[3-hydroxy-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-5-pentylphenoxy]oxane-3,4,5-triol |
| SMILES | CCCCCc1cc(O)c([C@@H]2C[C@H](C)CC[C@H]2C(C)C)c(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C27H44O7/c1-5-6-7-8-17-12-20(29)23(19-11-16(4)9-10-18(19)15(2)3)21(13-17)33-27-26(32)25(31)24(30)22(14-28)34-27/h12-13,15-16,18-19,22,24-32H,5-11,14H2,1-4H3/t16-,18+,19-,22-,24-,25+,26-,27-/m1/s1 |
| InChIKey | FPKXMWAECQSIOW-XMFAGKBYSA-N |
| XLogP | 3.48 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.64 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|