C33H50O12 — CID 172873399
2-(hydroxymethyl)-6-[[3,4,5-trihydroxy-6-[(6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl)oxy]oxan-2-yl]methoxy]oxane-3,4,5-triol (PubChem CID 172873399) has the molecular formula C33H50O12 and a molecular weight of 638.75 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-[[3,4,5-trihydroxy-6-[(6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl)oxy]oxan-2-yl]methoxy]oxane-3,4,5-triol.
| Compound Name | 2-(hydroxymethyl)-6-[[3,4,5-trihydroxy-6-[(6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl)oxy]oxan-2-yl]methoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 172873399 |
| Molecular Formula | C33H50O12 |
| Molecular Weight | 638.75 g/mol |
| Exact Mass | 638.33 |
| IUPAC Name | 2-(hydroxymethyl)-6-[[3,4,5-trihydroxy-6-[(6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl)oxy]oxan-2-yl]methoxy]oxane-3,4,5-triol |
| SMILES | CCCCCc1cc(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O)C(O)C2O)c2c(c1)OC(C)(C)C1CCC(C)=CC21 |
| InChI | InChI=1S/C33H50O12/c1-5-6-7-8-17-12-20(24-18-11-16(2)9-10-19(18)33(3,4)45-21(24)13-17)42-32-30(40)28(38)26(36)23(44-32)15-41-31-29(39)27(37)25(35)22(14-34)43-31/h11-13,18-19,22-23,25-32,34-40H,5-10,14-15H2,1-4H3 |
| InChIKey | RZFRCPSGNXCKHX-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 187.76 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.75 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|