C33H52O9 — CID 11786666
(2S,3R,4R,5R,6R)-2-methyl-6-[2-[2-[2-[(6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl)oxy]ethoxy]ethoxy]ethoxy]oxane-3,4,5-triol (PubChem CID 11786666) has the molecular formula C33H52O9 and a molecular weight of 592.77 g/mol. Its IUPAC name is (2S,3R,4R,5R,6R)-2-methyl-6-[2-[2-[2-[(6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl)oxy]ethoxy]ethoxy]ethoxy]oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5R,6R)-2-methyl-6-[2-[2-[2-[(6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl)oxy]ethoxy]ethoxy]ethoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 11786666 |
| Molecular Formula | C33H52O9 |
| Molecular Weight | 592.77 g/mol |
| Exact Mass | 592.36 |
| IUPAC Name | (2S,3R,4R,5R,6R)-2-methyl-6-[2-[2-[2-[(6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl)oxy]ethoxy]ethoxy]ethoxy]oxane-3,4,5-triol |
| SMILES | CCCCCc1cc(OCCOCCOCCO[C@@H]2O[C@@H](C)[C@H](O)[C@@H](O)[C@H]2O)c2c(c1)OC(C)(C)C1CCC(C)=CC21 |
| InChI | InChI=1S/C33H52O9/c1-6-7-8-9-23-19-26(28-24-18-21(2)10-11-25(24)33(4,5)42-27(28)20-23)39-16-14-37-12-13-38-15-17-40-32-31(36)30(35)29(34)22(3)41-32/h18-20,22,24-25,29-32,34-36H,6-17H2,1-5H3/t22-,24?,25?,29-,30+,31+,32+/m0/s1 |
| InChIKey | YCAAHECJZBHICR-QCXQYCCLSA-N |
| XLogP | 4.29 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.77 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|