C46H62O5 — CID 172914325
1-[2-[2-[[(6aR,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl]oxy]ethoxy]ethoxy]-6,6,9-trimethyl-3-pentylbenzo[c]chromene (PubChem CID 172914325) has the molecular formula C46H62O5 and a molecular weight of 695.00 g/mol. Its IUPAC name is 1-[2-[2-[[(6aR,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl]oxy]ethoxy]ethoxy]-6,6,9-trimethyl-3-pentylbenzo[c]chromene.
| Compound Name | 1-[2-[2-[[(6aR,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl]oxy]ethoxy]ethoxy]-6,6,9-trimethyl-3-pentylbenzo[c]chromene |
|---|---|
| PubChem CID | 172914325 |
| Molecular Formula | C46H62O5 |
| Molecular Weight | 695.00 g/mol |
| Exact Mass | 694.46 |
| IUPAC Name | 1-[2-[2-[[(6aR,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl]oxy]ethoxy]ethoxy]-6,6,9-trimethyl-3-pentylbenzo[c]chromene |
| SMILES | CCCCCc1cc(OCCOCCOc2cc(CCCCC)cc3c2[C@@H]2C=C(C)CC[C@H]2C(C)(C)O3)c2c(c1)OC(C)(C)c1ccc(C)cc1-2 |
| InChI | InChI=1S/C46H62O5/c1-9-11-13-15-33-27-39(43-35-25-31(3)17-19-37(35)45(5,6)50-41(43)29-33)48-23-21-47-22-24-49-40-28-34(16-14-12-10-2)30-42-44(40)36-26-32(4)18-20-38(36)46(7,8)51-42/h17,19,25-30,36,38H,9-16,18,20-24H2,1-8H3/t36-,38-/m1/s1 |
| InChIKey | UGEMSYSMUZSCFP-XXKIVBBDSA-N |
| XLogP | 11.84 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.00 |
| LogP ≤ 5 | 11.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|