C21H33FO2 — CID 171490597
2-(4-fluoro-5-methyl-2-propan-2-ylcyclohexyl)-5-pentylbenzene-1,3-diol (PubChem CID 171490597) has the molecular formula C21H33FO2 and a molecular weight of 336.49 g/mol. Its IUPAC name is 2-(4-fluoro-5-methyl-2-propan-2-ylcyclohexyl)-5-pentylbenzene-1,3-diol.
| Compound Name | 2-(4-fluoro-5-methyl-2-propan-2-ylcyclohexyl)-5-pentylbenzene-1,3-diol |
|---|---|
| PubChem CID | 171490597 |
| Molecular Formula | C21H33FO2 |
| Molecular Weight | 336.49 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | 2-(4-fluoro-5-methyl-2-propan-2-ylcyclohexyl)-5-pentylbenzene-1,3-diol |
| SMILES | CCCCCc1cc(O)c(C2CC(C)C(F)CC2C(C)C)c(O)c1 |
| InChI | InChI=1S/C21H33FO2/c1-5-6-7-8-15-10-19(23)21(20(24)11-15)17-9-14(4)18(22)12-16(17)13(2)3/h10-11,13-14,16-18,23-24H,5-9,12H2,1-4H3 |
| InChIKey | OPBHLYGIQUJVKD-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.49 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|