C42H66O4 — CID 172869952
4-[2,4-dihydroxy-3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-6-pentylphenyl]-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-5-pentylbenzene-1,3-diol (PubChem CID 172869952) has the molecular formula C42H66O4 and a molecular weight of 634.99 g/mol. Its IUPAC name is 4-[2,4-dihydroxy-3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-6-pentylphenyl]-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-5-pentylbenzene-1,3-diol.
| Compound Name | 4-[2,4-dihydroxy-3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-6-pentylphenyl]-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-5-pentylbenzene-1,3-diol |
|---|---|
| PubChem CID | 172869952 |
| Molecular Formula | C42H66O4 |
| Molecular Weight | 634.99 g/mol |
| Exact Mass | 634.50 |
| IUPAC Name | 4-[2,4-dihydroxy-3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-6-pentylphenyl]-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-5-pentylbenzene-1,3-diol |
| SMILES | CCCCCc1cc(O)c([C@@H]2C[C@H](C)CC[C@H]2C(C)C)c(O)c1-c1c(CCCCC)cc(O)c([C@@H]2C[C@H](C)CC[C@H]2C(C)C)c1O |
| InChI | InChI=1S/C42H66O4/c1-9-11-13-15-29-23-35(43)39(33-21-27(7)17-19-31(33)25(3)4)41(45)37(29)38-30(16-14-12-10-2)24-36(44)40(42(38)46)34-22-28(8)18-20-32(34)26(5)6/h23-28,31-34,43-46H,9-22H2,1-8H3/t27-,28-,31+,32+,33-,34-/m1/s1 |
| InChIKey | ZJYKVXPZSLZYTO-JNBMXARQSA-N |
| XLogP | 11.99 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.99 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|