C21H33FO3 — CID 176836094
4-fluoro-2-[2-(2-hydroxypropan-2-yl)-5-methylcyclohexyl]-5-pentylbenzene-1,3-diol (PubChem CID 176836094) has the molecular formula C21H33FO3 and a molecular weight of 352.49 g/mol. Its IUPAC name is 4-fluoro-2-[2-(2-hydroxypropan-2-yl)-5-methylcyclohexyl]-5-pentylbenzene-1,3-diol.
| Compound Name | 4-fluoro-2-[2-(2-hydroxypropan-2-yl)-5-methylcyclohexyl]-5-pentylbenzene-1,3-diol |
|---|---|
| PubChem CID | 176836094 |
| Molecular Formula | C21H33FO3 |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 4-fluoro-2-[2-(2-hydroxypropan-2-yl)-5-methylcyclohexyl]-5-pentylbenzene-1,3-diol |
| SMILES | CCCCCc1cc(O)c(C2CC(C)CCC2C(C)(C)O)c(O)c1F |
| InChI | InChI=1S/C21H33FO3/c1-5-6-7-8-14-12-17(23)18(20(24)19(14)22)15-11-13(2)9-10-16(15)21(3,4)25/h12-13,15-16,23-25H,5-11H2,1-4H3 |
| InChIKey | WNCKJHVFBVAJMD-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|