C19H18F4O — CID 139776693
3,4,5,6-tetrafluoro-7-pentyl-9,10-dihydrophenanthren-2-ol (PubChem CID 139776693) has the molecular formula C19H18F4O and a molecular weight of 338.34 g/mol. Its IUPAC name is 3,4,5,6-tetrafluoro-7-pentyl-9,10-dihydrophenanthren-2-ol.
| Compound Name | 3,4,5,6-tetrafluoro-7-pentyl-9,10-dihydrophenanthren-2-ol |
|---|---|
| PubChem CID | 139776693 |
| Molecular Formula | C19H18F4O |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 3,4,5,6-tetrafluoro-7-pentyl-9,10-dihydrophenanthren-2-ol |
| SMILES | CCCCCc1cc2c(c(F)c1F)-c1c(cc(O)c(F)c1F)CC2 |
| InChI | InChI=1S/C19H18F4O/c1-2-3-4-5-12-8-10-6-7-11-9-13(24)17(21)19(23)15(11)14(10)18(22)16(12)20/h8-9,24H,2-7H2,1H3 |
| InChIKey | KBURONMGIJUXSB-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|