C24H36O2 — CID 176911728
(6aR,10aR)-6,6,9-trimethyl-3-pentyl-2-prop-2-enyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-ol (PubChem CID 176911728) has the molecular formula C24H36O2 and a molecular weight of 356.55 g/mol. Its IUPAC name is (6aR,10aR)-6,6,9-trimethyl-3-pentyl-2-prop-2-enyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-ol.
| Compound Name | (6aR,10aR)-6,6,9-trimethyl-3-pentyl-2-prop-2-enyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 176911728 |
| Molecular Formula | C24H36O2 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | (6aR,10aR)-6,6,9-trimethyl-3-pentyl-2-prop-2-enyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-ol |
| SMILES | C=CCc1c(CCCCC)cc2c(c1O)[C@@H]1CC(C)CC[C@H]1C(C)(C)O2 |
| InChI | InChI=1S/C24H36O2/c1-6-8-9-11-17-15-21-22(23(25)18(17)10-7-2)19-14-16(3)12-13-20(19)24(4,5)26-21/h7,15-16,19-20,25H,2,6,8-14H2,1,3-5H3/t16?,19-,20-/m1/s1 |
| InChIKey | GBLPYLMDWVFRGC-ODFWGIBRSA-N |
| XLogP | 6.54 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|