C17H24O2 — CID 175224413
(6aR,10aR)-3,6,6,9-tetramethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-ol (PubChem CID 175224413) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is (6aR,10aR)-3,6,6,9-tetramethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-ol.
| Compound Name | (6aR,10aR)-3,6,6,9-tetramethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 175224413 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (6aR,10aR)-3,6,6,9-tetramethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-ol |
| SMILES | Cc1cc(O)c2c(c1)OC(C)(C)[C@@H]1CCC(C)C[C@@H]21 |
| InChI | InChI=1S/C17H24O2/c1-10-5-6-13-12(7-10)16-14(18)8-11(2)9-15(16)19-17(13,3)4/h8-10,12-13,18H,5-7H2,1-4H3/t10?,12-,13-/m1/s1 |
| InChIKey | NJEVKSYKELTXNY-SKVSWLLESA-N |
| XLogP | 4.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |