C16H20O4 — CID 46900275
(6aR,9S,10aR)-1,9-dihydroxy-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromene-3-carbaldehyde (PubChem CID 46900275) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is (6aR,9S,10aR)-1,9-dihydroxy-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromene-3-carbaldehyde.
| Compound Name | (6aR,9S,10aR)-1,9-dihydroxy-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromene-3-carbaldehyde |
|---|---|
| PubChem CID | 46900275 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (6aR,9S,10aR)-1,9-dihydroxy-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromene-3-carbaldehyde |
| SMILES | CC1(C)Oc2cc(C=O)cc(O)c2[C@@H]2C[C@@H](O)CC[C@H]21 |
| InChI | InChI=1S/C16H20O4/c1-16(2)12-4-3-10(18)7-11(12)15-13(19)5-9(8-17)6-14(15)20-16/h5-6,8,10-12,18-19H,3-4,7H2,1-2H3/t10-,11+,12+/m0/s1 |
| InChIKey | NYYAHIOAOITQKV-QJPTWQEYSA-N |
| XLogP | 2.62 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|