C20H22O4S — CID 66552192
[(6aR,9R,10aR)-1,9-dihydroxy-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-3-yl]-thiophen-2-ylmethanone (PubChem CID 66552192) has the molecular formula C20H22O4S and a molecular weight of 358.46 g/mol. Its IUPAC name is [(6aR,9R,10aR)-1,9-dihydroxy-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-3-yl]-thiophen-2-ylmethanone.
| Compound Name | [(6aR,9R,10aR)-1,9-dihydroxy-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-3-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 66552192 |
| Molecular Formula | C20H22O4S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | [(6aR,9R,10aR)-1,9-dihydroxy-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-3-yl]-thiophen-2-ylmethanone |
| SMILES | CC1(C)Oc2cc(C(=O)c3cccs3)cc(O)c2[C@@H]2C[C@H](O)CC[C@H]21 |
| InChI | InChI=1S/C20H22O4S/c1-20(2)14-6-5-12(21)10-13(14)18-15(22)8-11(9-16(18)24-20)19(23)17-4-3-7-25-17/h3-4,7-9,12-14,21-22H,5-6,10H2,1-2H3/t12-,13-,14-/m1/s1 |
| InChIKey | SLXAGBNQHNNLFG-MGPQQGTHSA-N |
| XLogP | 4.10 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |