C25H31NO6 — CID 66552067
[(6aR,9R,10aR)-1,9-bis(methoxymethoxy)-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-3-yl]-pyridin-3-ylmethanone (PubChem CID 66552067) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is [(6aR,9R,10aR)-1,9-bis(methoxymethoxy)-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-3-yl]-pyridin-3-ylmethanone.
| Compound Name | [(6aR,9R,10aR)-1,9-bis(methoxymethoxy)-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-3-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 66552067 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | [(6aR,9R,10aR)-1,9-bis(methoxymethoxy)-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-3-yl]-pyridin-3-ylmethanone |
| SMILES | COCOc1cc(C(=O)c2cccnc2)cc2c1[C@@H]1C[C@H](OCOC)CC[C@H]1C(C)(C)O2 |
| InChI | InChI=1S/C25H31NO6/c1-25(2)20-8-7-18(30-14-28-3)12-19(20)23-21(31-15-29-4)10-17(11-22(23)32-25)24(27)16-6-5-9-26-13-16/h5-6,9-11,13,18-20H,7-8,12,14-15H2,1-4H3/t18-,19-,20-/m1/s1 |
| InChIKey | UBWOPYYIGXCUDE-VAMGGRTRSA-N |
| XLogP | 4.34 |
| TPSA | 76.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|