C23H29NO6S — CID 66552064
[(6aR,9R,10aR)-1,9-bis(methoxymethoxy)-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-3-yl]-(1,3-thiazol-4-yl)methanone (PubChem CID 66552064) has the molecular formula C23H29NO6S and a molecular weight of 447.55 g/mol. Its IUPAC name is [(6aR,9R,10aR)-1,9-bis(methoxymethoxy)-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-3-yl]-(1,3-thiazol-4-yl)methanone.
| Compound Name | [(6aR,9R,10aR)-1,9-bis(methoxymethoxy)-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-3-yl]-(1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 66552064 |
| Molecular Formula | C23H29NO6S |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | [(6aR,9R,10aR)-1,9-bis(methoxymethoxy)-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-3-yl]-(1,3-thiazol-4-yl)methanone |
| SMILES | COCOc1cc(C(=O)c2cscn2)cc2c1[C@@H]1C[C@H](OCOC)CC[C@H]1C(C)(C)O2 |
| InChI | InChI=1S/C23H29NO6S/c1-23(2)17-6-5-15(28-12-26-3)9-16(17)21-19(29-13-27-4)7-14(8-20(21)30-23)22(25)18-10-31-11-24-18/h7-8,10-11,15-17H,5-6,9,12-13H2,1-4H3/t15-,16-,17-/m1/s1 |
| InChIKey | JMFZKERFMAXILF-BRWVUGGUSA-N |
| XLogP | 4.40 |
| TPSA | 76.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|